ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-91-2 4-etylo-5-metylotiazol |
|
| Nazwa produktu: | 4-etylo-5-metylotiazol |
| Synonimy | 4-etylo-5-metylotiazol; Tiazol, 4-etylo-5-metylo-; 4-etylo-5-metylo-1,3-tiazol; |
| Angielska nazwa | 4-ethyl-5-methylthiazole;4-Ethyl-5-methylthiazole;Thiazole, 4-ethyl-5-methyl-;4-ethyl-5-methyl-1,3-thiazole |
| MF | C6H9NS |
| Masie cząsteczkowej | 127.2074 |
| InChI | InChI=1/C6H9NS/c1-3-6-5(2)8-4-7-6/h4H,3H2,1-2H3 |
| Nr CAS | 52414-91-2 |
| EINECS | 257-904-5 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.049g/cm3 |
| Temperatura wrzenia | 181.3°C at 760 mmHg |
| Współczynnik załamania | 1.524 |
| Temperatura zapłonu | 68.1°C |
| Ciśnienie pary | 1.17mmHg at 25°C |
| MSDS | |