ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-91-2 4-etil-5-metiltiazol |
|
| Nome do produto | 4-etil-5-metiltiazol |
| Sinônimos | 4-Etil-5-metiltiazol; tiazol, 4-etil-5-metil-; 4-etil-5-metil-1,3-tiazol; |
| Nome em inglês | 4-ethyl-5-methylthiazole;4-Ethyl-5-methylthiazole;Thiazole, 4-ethyl-5-methyl-;4-ethyl-5-methyl-1,3-thiazole |
| Fórmula molecular | C6H9NS |
| Peso Molecular | 127.2074 |
| InChI | InChI=1/C6H9NS/c1-3-6-5(2)8-4-7-6/h4H,3H2,1-2H3 |
| CAS Registry Number | 52414-91-2 |
| EINECS | 257-904-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.049g/cm3 |
| Ponto de ebulição | 181.3°C at 760 mmHg |
| índice de refração | 1.524 |
| O ponto de inflamação | 68.1°C |
| Pressão de vapor | 1.17mmHg at 25°C |
| MSDS | |