ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5425-44-5 2-Phenyl-1,3-dithian |
|
Produkt-Name | 2-Phenyl-1,3-dithian |
Synonyme | m-Dithian, 2-Phenyl-; 1,3-Dithian, 2-Phenyl-; 2-Phenyl-1,3-dithian; 2-Phenyl-m-dithian; 5-19-01-00462 (Beilstein-Handbuch-Referenz); BRN 0130879; NSC 12763; 1,3-Dithian, 2-Phenyl- (9CI) |
Englischer Name | 2-phenyl-1,3-dithiane;m-Dithiane, 2-phenyl-;1,3-Dithiane, 2-phenyl-;2-Phenyl-1,3-dithiane;2-Phenyl-m-dithiane;5-19-01-00462 (Beilstein Handbook Reference);BRN 0130879;NSC 12763;1,3-Dithiane, 2-phenyl- (9CI) |
Molekulare Formel | C10H12S2 |
Molecular Weight | 196.3323 |
InChl | InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
CAS Registry Number | 5425-44-5 |
EINECS | 226-568-1 |
Molecular Structure | ![]() |
Dichte | 1.157g/cm3 |
Siedepunkt | 326.8°C at 760 mmHg |
Brechungsindex | 1.615 |
Flammpunkt | 158.3°C |
Dampfdruck | 0.0004mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |