ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5425-44-5 2-फिनाइल-1,3-डिथियान |
|
उत्पाद का नाम | 2-फिनाइल-1,3-डिथियान |
समानार्थी | एम-डिथियाने, 2-फिनाइल-; 1,3-डिथियाने, 2-फिनाइल-; 2-फिनाइल-1,3-डिथियान; 2-फिनाइल-एम-डिथियान; 5-19-01-00462 (Beilstein हैंडबुक संदर्भ); बीआरएन 0130879; एनएससी 12763; 1,3-डिथियाने, 2-फिनाइल- (9CI) |
अंग्रेज | 2-phenyl-1,3-dithiane;m-Dithiane, 2-phenyl-;1,3-Dithiane, 2-phenyl-;2-Phenyl-1,3-dithiane;2-Phenyl-m-dithiane;5-19-01-00462 (Beilstein Handbook Reference);BRN 0130879;NSC 12763;1,3-Dithiane, 2-phenyl- (9CI) |
आणविक फार्मूला | C10H12S2 |
आण्विक वजन | 196.3323 |
InChI | InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
कैस रजिस्टी संख्या | 5425-44-5 |
EINECS | 226-568-1 |
आणविक संरचना | ![]() |
घनत्व | 1.157g/cm3 |
उबलने का समय | 326.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.615 |
फ्लैश प्वाइंट | 158.3°C |
वाष्प का दबाव | 0.0004mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |