ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5425-44-5 2-fenyl-1,3-dithiaan |
|
Naam product | 2-fenyl-1,3-dithiaan |
Synoniemen | m-Dithiaan, 2-fenyl-; 1,3-dithiaan, 2-fenyl-; 2-fenyl-1,3-dithiaan; 2-fenyl-m-dithiaan; 5-19-01-00462 (Beilstein Handboek Referentie); BRN 0130879; NSC 12763; 1,3-dithiaan, 2-fenyl- (9CI) |
Engelse naam | 2-phenyl-1,3-dithiane;m-Dithiane, 2-phenyl-;1,3-Dithiane, 2-phenyl-;2-Phenyl-1,3-dithiane;2-Phenyl-m-dithiane;5-19-01-00462 (Beilstein Handbook Reference);BRN 0130879;NSC 12763;1,3-Dithiane, 2-phenyl- (9CI) |
MF | C10H12S2 |
Molecuulgewicht | 196.3323 |
InChI | InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
CAS-nummer | 5425-44-5 |
EINECS | 226-568-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.157g/cm3 |
Kookpunt | 326.8°C at 760 mmHg |
Brekingsindex | 1.615 |
Vlampunt | 158.3°C |
Dampdruk | 0.0004mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |