ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54263-82-0 3-Dimethylaminobenzoylchlorid |
|
Produkt-Name | 3-Dimethylaminobenzoylchlorid |
Englischer Name | 3-Dimethylaminobenzoyl chloride; |
Molekulare Formel | C9H10ClNO |
Molecular Weight | 183.6348 |
InChl | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
CAS Registry Number | 54263-82-0 |
Molecular Structure | ![]() |
Dichte | 1.193g/cm3 |
Siedepunkt | 275.9°C at 760 mmHg |
Brechungsindex | 1.574 |
Flammpunkt | 120.7°C |
Dampfdruck | 0.00495mmHg at 25°C |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |