ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54263-82-0 3-Dimethylaminobenzoyl כלוריד |
|
שם המוצר | 3-Dimethylaminobenzoyl כלוריד |
שם אנגלי | 3-Dimethylaminobenzoyl chloride; |
מולקולרית פורמולה | C9H10ClNO |
משקל מולקולרי | 183.6348 |
InChl | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
מספר CAS | 54263-82-0 |
מבנה מולקולרי | ![]() |
צפיפות | 1.193g/cm3 |
נקודת רתיחה | 275.9°C at 760 mmHg |
משקל סגולי | 1.574 |
נקודת הבזק | 120.7°C |
לחץ אדים | 0.00495mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |