ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54263-82-0 3-دی متیل امین بنزوئیل کلرید؛ |
|
نام محصول | 3-دی متیل امین بنزوئیل کلرید؛ |
نام انگلیسی | 3-Dimethylaminobenzoyl chloride; |
میدان مغناطیسی | C9H10ClNO |
وزن مولکولی | 183.6348 |
InChI | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
شماره سیایاس | 54263-82-0 |
ساختار مولکولی | ![]() |
تراکم | 1.193g/cm3 |
نقطه غلیان | 275.9°C at 760 mmHg |
ضریب شکست | 1.574 |
نقطه اشتعال | 120.7°C |
فشار بخار | 0.00495mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |