ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54381-13-4 4-Methoxy-2'-Nitrodiphenylamine |
|
| Produkt-Name | 4-Methoxy-2'-Nitrodiphenylamine |
| Englischer Name | 4-Methoxy-2'-Nitrodiphenylamine;Ethyl-2-Oxo-4-Phenylbutylbutyrate Ethyl-2-Methylethyl-3-Oxo-4-Phenylbutanoate;N-(4-methoxyphenyl)-2-nitroaniline |
| Molekulare Formel | C13H12N2O3 |
| Molecular Weight | 244.246 |
| InChl | InChI=1/C13H12N2O3/c1-18-11-8-6-10(7-9-11)14-12-4-2-3-5-13(12)15(16)17/h2-9,14H,1H3 |
| CAS Registry Number | 54381-13-4 |
| Molecular Structure | ![]() |
| Dichte | 1.276g/cm3 |
| Siedepunkt | 387.9°C at 760 mmHg |
| Brechungsindex | 1.639 |
| Flammpunkt | 188.4°C |
| Dampfdruck | 3.18E-06mmHg at 25°C |
| MSDS | |