ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54381-13-4 4-Methoxy-2'-Nitrodiphenylamine |
|
| Naam product | 4-Methoxy-2'-Nitrodiphenylamine |
| Engelse naam | 4-Methoxy-2'-Nitrodiphenylamine;Ethyl-2-Oxo-4-Phenylbutylbutyrate Ethyl-2-Methylethyl-3-Oxo-4-Phenylbutanoate;N-(4-methoxyphenyl)-2-nitroaniline |
| MF | C13H12N2O3 |
| Molecuulgewicht | 244.246 |
| InChI | InChI=1/C13H12N2O3/c1-18-11-8-6-10(7-9-11)14-12-4-2-3-5-13(12)15(16)17/h2-9,14H,1H3 |
| CAS-nummer | 54381-13-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.276g/cm3 |
| Kookpunt | 387.9°C at 760 mmHg |
| Brekingsindex | 1.639 |
| Vlampunt | 188.4°C |
| Dampdruk | 3.18E-06mmHg at 25°C |
| MSDS | |