ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54381-13-4 4-Methoxy-2'-Nitrodiphenylamine |
|
| produktnavn | 4-Methoxy-2'-Nitrodiphenylamine |
| Engelsk navn | 4-Methoxy-2'-Nitrodiphenylamine;Ethyl-2-Oxo-4-Phenylbutylbutyrate Ethyl-2-Methylethyl-3-Oxo-4-Phenylbutanoate;N-(4-methoxyphenyl)-2-nitroaniline |
| Molekylær Formel | C13H12N2O3 |
| Molekylvekt | 244.246 |
| InChI | InChI=1/C13H12N2O3/c1-18-11-8-6-10(7-9-11)14-12-4-2-3-5-13(12)15(16)17/h2-9,14H,1H3 |
| CAS-nummer | 54381-13-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.276g/cm3 |
| Kokepunkt | 387.9°C at 760 mmHg |
| Brytningsindeks | 1.639 |
| Flammepunktet | 188.4°C |
| Damptrykk | 3.18E-06mmHg at 25°C |
| MSDS | |