ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
576-82-9 5-Fluor-1,2,3-tribrombenzol |
|
Produkt-Name | 5-Fluor-1,2,3-tribrombenzol |
Synonyme | 1,2,3-Tribrom-5-fluorbenzol; |
Englischer Name | 5-Fluoro-1,2,3-tribromobenzene;1,2,3-Tribromo-5-fluorobenzene |
Molekulare Formel | C6H2Br3F |
Molecular Weight | 332.7905 |
InChl | InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS Registry Number | 576-82-9 |
Molecular Structure | ![]() |
Dichte | 2.34g/cm3 |
Siedepunkt | 274.2°C at 760 mmHg |
Brechungsindex | 1.61 |
Flammpunkt | 119.6°C |
Dampfdruck | 0.0092mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |