ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
576-82-9 5-fluor-1,2,3-tribromobenzen |
|
produktnavn | 5-fluor-1,2,3-tribromobenzen |
Synonymer | ; 1,2,3-Tribromo-5-fluorbenzen; |
Engelsk navn | 5-Fluoro-1,2,3-tribromobenzene;1,2,3-Tribromo-5-fluorobenzene |
Molekylær Formel | C6H2Br3F |
Molekylvekt | 332.7905 |
InChI | InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS-nummer | 576-82-9 |
Molecular Structure | ![]() |
Tetthet | 2.34g/cm3 |
Kokepunkt | 274.2°C at 760 mmHg |
Brytningsindeks | 1.61 |
Flammepunktet | 119.6°C |
Damptrykk | 0.0092mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |