ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
576-82-9 5-Fluoro-1,2,3-tribromobenzena |
|
Nama produk | 5-Fluoro-1,2,3-tribromobenzena |
Sinonim | ; 1,2,3-Tribromo-5-fluorobenzena; |
Nama bahasa Inggris | 5-Fluoro-1,2,3-tribromobenzene;1,2,3-Tribromo-5-fluorobenzene |
MF | C6H2Br3F |
Berat Molekul | 332.7905 |
InChI | InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS NO | 576-82-9 |
Struktur Molekul | ![]() |
Kepadatan | 2.34g/cm3 |
Titik didih | 274.2°C at 760 mmHg |
Indeks bias | 1.61 |
Titik nyala | 119.6°C |
Tekanan uap | 0.0092mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |