ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-26-8 2-Nitrobenzhydrazide |
|
| Produkt-Name | 2-Nitrobenzhydrazide |
| Englischer Name | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
| Molekulare Formel | C7H7N3O3 |
| Molecular Weight | 181.1488 |
| InChl | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS Registry Number | 606-26-8 |
| EINECS | 210-110-2 |
| Molecular Structure | ![]() |
| Dichte | 1.406g/cm3 |
| Schmelzpunkt | 123℃ |
| Brechungsindex | 1.621 |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |