ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-26-8 2-Nitrobenzhydrazide |
|
| Naam product | 2-Nitrobenzhydrazide |
| Engelse naam | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
| MF | C7H7N3O3 |
| Molecuulgewicht | 181.1488 |
| InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS-nummer | 606-26-8 |
| EINECS | 210-110-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.406g/cm3 |
| Smeltpunt | 123℃ |
| Brekingsindex | 1.621 |
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |