ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-26-8 2-Nitrobenzhydrazide |
|
| produktnavn | 2-Nitrobenzhydrazide |
| Engelsk navn | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
| Molekylær Formel | C7H7N3O3 |
| Molekylvekt | 181.1488 |
| InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS-nummer | 606-26-8 |
| EINECS | 210-110-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.406g/cm3 |
| Smeltepunkt | 123℃ |
| Brytningsindeks | 1.621 |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |