ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 2-Nitrophenylacetat |
|
| Produkt-Name | 2-Nitrophenylacetat |
| Synonyme | 2-Nitrophenylacetat; Essigsäure-2-nitrophenylester; |
| Englischer Name | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
| Molekulare Formel | C8H7NO4 |
| Molecular Weight | 181.1455 |
| InChl | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| CAS Registry Number | 610-69-5 |
| EINECS | 210-233-1 |
| Molecular Structure | ![]() |
| Dichte | 1.304g/cm3 |
| Schmelzpunkt | 39-41℃ |
| Siedepunkt | 274.8°C at 760 mmHg |
| Brechungsindex | 1.548 |
| Flammpunkt | 139.8°C |
| Dampfdruck | 0.00528mmHg at 25°C |
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |