ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 2-nitrofenylacetaat |
|
| Naam product | 2-nitrofenylacetaat |
| Synoniemen | 2-nitrofenylacetaat; Azijnzuur-2-nitrofenylester; |
| Engelse naam | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
| MF | C8H7NO4 |
| Molecuulgewicht | 181.1455 |
| InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| CAS-nummer | 610-69-5 |
| EINECS | 210-233-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.304g/cm3 |
| Smeltpunt | 39-41℃ |
| Kookpunt | 274.8°C at 760 mmHg |
| Brekingsindex | 1.548 |
| Vlampunt | 139.8°C |
| Dampdruk | 0.00528mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |