ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-36-7 Ethyl oxamate | 
    |
| Produkt-Name | Ethyl oxamate | 
| Englischer Name | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate | 
| Molekulare Formel | C4H7NO3 | 
| Molecular Weight | 117.1033 | 
| InChl | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) | 
| CAS Registry Number | 617-36-7 | 
| EINECS | 210-512-8 | 
| Molecular Structure | ![]()  | 
    
| Dichte | 1.184g/cm3 | 
| Schmelzpunkt | 112-115℃ | 
| Siedepunkt | 188.7°C at 760 mmHg | 
| Brechungsindex | 1.437 | 
| Flammpunkt | 87°C | 
| Dampfdruck | 0.59mmHg at 25°C | 
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |