ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-36-7 Ethyl oxamate | |
| 상품명칭 | Ethyl oxamate | 
| 영문 이름 | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate | 
| 분자식 | C4H7NO3 | 
| 분자량 | 117.1033 | 
| InChI | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) | 
| cas번호 | 617-36-7 | 
| EC번호 | 210-512-8 | 
| 분자 구조 |  | 
| 밀도 | 1.184g/cm3 | 
| 녹는 점 | 112-115℃ | 
| 비등점 | 188.7°C at 760 mmHg | 
| 굴절 지수 | 1.437 | 
| 인화점 | 87°C | 
| 증기압 | 0.59mmHg at 25°C | 
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |