ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-36-7 Ethyl oxamate | |
| Nome del prodotto | Ethyl oxamate | 
| Nome inglese | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate | 
| Formula molecolare | C4H7NO3 | 
| Peso Molecolare | 117.1033 | 
| InChI | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) | 
| Numero CAS | 617-36-7 | 
| EINECS | 210-512-8 | 
| Struttura molecolare |  | 
| Densità | 1.184g/cm3 | 
| Punto di fusione | 112-115℃ | 
| Punto di ebollizione | 188.7°C at 760 mmHg | 
| Indice di rifrazione | 1.437 | 
| Punto d'infiammabilità | 87°C | 
| Pressione di vapore | 0.59mmHg at 25°C | 
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |