ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68837-59-2 4-Bromo-2-methylbenzoic acid |
|
Produkt-Name | 4-Bromo-2-methylbenzoic acid |
Englischer Name | 4-Bromo-2-methylbenzoic acid;2-Methyl-4-Bromobenzoic acid;RARECHEM AL BO 0455;4-Bromo-o-toluic acid |
Molekulare Formel | C8H7BrO2 |
Molecular Weight | 215.044 |
InChl | InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS Registry Number | 68837-59-2 |
EINECS | 272-437-7 |
Molecular Structure | ![]() |
Dichte | 1.599g/cm3 |
Schmelzpunkt | 180-184℃ |
Siedepunkt | 310.1°C at 760 mmHg |
Brechungsindex | 1.595 |
Flammpunkt | 141.3°C |
Dampfdruck | 0.000264mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R22:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |