ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68837-59-2 4-Bromo-2-methylbenzoic acid |
|
Nama produk | 4-Bromo-2-methylbenzoic acid |
Nama bahasa Inggris | 4-Bromo-2-methylbenzoic acid;2-Methyl-4-Bromobenzoic acid;RARECHEM AL BO 0455;4-Bromo-o-toluic acid |
MF | C8H7BrO2 |
Berat Molekul | 215.044 |
InChI | InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS NO | 68837-59-2 |
EINECS | 272-437-7 |
Struktur Molekul | ![]() |
Kepadatan | 1.599g/cm3 |
Titik lebur | 180-184℃ |
Titik didih | 310.1°C at 760 mmHg |
Indeks bias | 1.595 |
Titik nyala | 141.3°C |
Tekanan uap | 0.000264mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R22:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |