ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68837-59-2 4-Bromo-2-methylbenzoic acid |
|
Nazwa produktu: | 4-Bromo-2-methylbenzoic acid |
Angielska nazwa | 4-Bromo-2-methylbenzoic acid;2-Methyl-4-Bromobenzoic acid;RARECHEM AL BO 0455;4-Bromo-o-toluic acid |
MF | C8H7BrO2 |
Masie cząsteczkowej | 215.044 |
InChI | InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
Nr CAS | 68837-59-2 |
EINECS | 272-437-7 |
Struktury molekularnej | ![]() |
Gęstość | 1.599g/cm3 |
Temperatura topnienia | 180-184℃ |
Temperatura wrzenia | 310.1°C at 760 mmHg |
Współczynnik załamania | 1.595 |
Temperatura zapłonu | 141.3°C |
Ciśnienie pary | 0.000264mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R22:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |