ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-42-1 2-Chloro-6-nitrotoluene |
|
| Produkt-Name | 2-Chloro-6-nitrotoluene |
| Englischer Name | 2-Chloro-6-nitrotoluene;2-Chloro-6-Nitotoluene;2-Nitro-6-Chlorotoluene;6-Chloro-2-nitrotoluene |
| Molekulare Formel | C7H6ClNO2 |
| Molecular Weight | 171.58 |
| InChl | InChI=1/C7H6ClNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| CAS Registry Number | 83-42-1 |
| EINECS | 201-475-9 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 33-37℃ |
| Siedepunkt | 238℃ |
| Flammpunkt | 125℃ |
| Wasserlöslichkeit | 92 mg/L (20℃) |
| Gefahrensymbole | |
| Risk Codes | R20/21/22||R36/37/38:; |
| Safety Beschreibung | S26||S36/37/39:; |
| MSDS | |