ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-42-1 2-Chloro-6-nitrotoluene |
|
| Nom | 2-Chloro-6-nitrotoluene |
| Nom anglais | 2-Chloro-6-nitrotoluene;2-Chloro-6-Nitotoluene;2-Nitro-6-Chlorotoluene;6-Chloro-2-nitrotoluene |
| Formule moléculaire | C7H6ClNO2 |
| Poids Moléculaire | 171.58 |
| InChl | InChI=1/C7H6ClNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| Numéro de registre CAS | 83-42-1 |
| EINECS | 201-475-9 |
| Structure moléculaire | ![]() |
| Point de fusion | 33-37℃ |
| Point d'ébullition | 238℃ |
| Point d'éclair | 125℃ |
| solubilité dans l'eau | 92 mg/L (20℃) |
| Les symboles de danger | |
| Codes des risques | R20/21/22||R36/37/38:; |
| Description de sécurité | S26||S36/37/39:; |
| MSDS | |