ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-42-1 2-Chloro-6-nitrotoluene |
|
| 상품명칭 | 2-Chloro-6-nitrotoluene |
| 영문 이름 | 2-Chloro-6-nitrotoluene;2-Chloro-6-Nitotoluene;2-Nitro-6-Chlorotoluene;6-Chloro-2-nitrotoluene |
| 분자식 | C7H6ClNO2 |
| 분자량 | 171.58 |
| InChI | InChI=1/C7H6ClNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| cas번호 | 83-42-1 |
| EC번호 | 201-475-9 |
| 분자 구조 | ![]() |
| 녹는 점 | 33-37℃ |
| 비등점 | 238℃ |
| 인화점 | 125℃ |
| 물 용해도 | 92 mg/L (20℃) |
| 위험성 표시 | |
| 리스크 규칙 | R20/21/22||R36/37/38:; |
| 보안 규칙 | S26||S36/37/39:; |
| MSDS | |