ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-68-1 2-Methylnaphthalin-1,4-diylamin |
|
| Produkt-Name | 2-Methylnaphthalin-1,4-diylamin |
| Synonyme | Vitamin K6; 2-Methylnaphthalin-1,4-diamin; |
| Englischer Name | 2-methylnaphthalene-1,4-diylamine;vitamin K6;2-methylnaphthalene-1,4-diamine |
| Molekulare Formel | C11H12N2 |
| Molecular Weight | 172.2264 |
| InChl | InChI=1/C11H12N2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,12-13H2,1H3 |
| CAS Registry Number | 83-68-1 |
| Molecular Structure | ![]() |
| Dichte | 1.193g/cm3 |
| Siedepunkt | 373.71°C at 760 mmHg |
| Brechungsindex | 1.726 |
| Flammpunkt | 214.572°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |