ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-68-1 2- 메틸 나프탈렌 -1,4- 디일아민 |
|
| 상품명칭 | 2- 메틸 나프탈렌 -1,4- 디일아민 |
| 별명 | ; 비타민 K6; 2-메틸나프탈렌-1,4-디아민; |
| 영문 이름 | 2-methylnaphthalene-1,4-diylamine;vitamin K6;2-methylnaphthalene-1,4-diamine |
| 분자식 | C11H12N2 |
| 분자량 | 172.2264 |
| InChI | InChI=1/C11H12N2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,12-13H2,1H3 |
| cas번호 | 83-68-1 |
| 분자 구조 | ![]() |
| 밀도 | 1.193g/cm3 |
| 비등점 | 373.71°C at 760 mmHg |
| 굴절 지수 | 1.726 |
| 인화점 | 214.572°C |
| 증기압 | 0mmHg at 25°C |
| MSDS | |