ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-68-1 2-méthylnaphtalène-1,4-diylamine |
|
| Nom | 2-méthylnaphtalène-1,4-diylamine |
| Synonymes | ; vitamine K6 ; 2-méthylnaphtalène-1,4-diamine ; |
| Nom anglais | 2-methylnaphthalene-1,4-diylamine;vitamin K6;2-methylnaphthalene-1,4-diamine |
| Formule moléculaire | C11H12N2 |
| Poids Moléculaire | 172.2264 |
| InChl | InChI=1/C11H12N2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,12-13H2,1H3 |
| Numéro de registre CAS | 83-68-1 |
| Structure moléculaire | ![]() |
| Densité | 1.193g/cm3 |
| Point d'ébullition | 373.71°C at 760 mmHg |
| Indice de réfraction | 1.726 |
| Point d'éclair | 214.572°C |
| Pression de vapeur | 0mmHg at 25°C |
| MSDS | |