ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85099-21-4 Methacrylsäure, Verbindung mit 2-(Dimethylamino)ethanol (1:1) |
|
| Produkt-Name | Methacrylsäure, Verbindung mit 2-(Dimethylamino)ethanol (1:1) |
| Synonyme | Methacrylsäure, Verbindung mit 2-(Dimethylamino)ethanol (1:1); 2-Methylprop-2-ensäure-2-(dimethylamino)ethanol (1:1); |
| Englischer Name | methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);Methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);2-methylprop-2-enoic acid - 2-(dimethylamino)ethanol (1:1) |
| Molekulare Formel | C8H17NO3 |
| Molecular Weight | 175.2255 |
| InChl | InChI=1/C4H11NO.C4H6O2/c1-5(2)3-4-6;1-3(2)4(5)6/h6H,3-4H2,1-2H3;1H2,2H3,(H,5,6) |
| CAS Registry Number | 85099-21-4 |
| EINECS | 285-475-4 |
| Molecular Structure | ![]() |
| Siedepunkt | 312.8°C at 760 mmHg |
| Flammpunkt | 143°C |
| Dampfdruck | 4.53E-05mmHg at 25°C |
| MSDS | |