ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85099-21-4 methacrylzuur, verbinding met 2-(dimethylamino)ethanol (1:1) |
|
Naam product | methacrylzuur, verbinding met 2-(dimethylamino)ethanol (1:1) |
Synoniemen | Methacrylzuur, verbinding met 2-(dimethylamino)ethanol (1:1); 2-methylprop-2-eenzuur - 2-(dimethylamino)ethanol (1:1); |
Engelse naam | methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);Methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);2-methylprop-2-enoic acid - 2-(dimethylamino)ethanol (1:1) |
MF | C8H17NO3 |
Molecuulgewicht | 175.2255 |
InChI | InChI=1/C4H11NO.C4H6O2/c1-5(2)3-4-6;1-3(2)4(5)6/h6H,3-4H2,1-2H3;1H2,2H3,(H,5,6) |
CAS-nummer | 85099-21-4 |
EINECS | 285-475-4 |
Moleculaire Structuur | ![]() |
Kookpunt | 312.8°C at 760 mmHg |
Vlampunt | 143°C |
Dampdruk | 4.53E-05mmHg at 25°C |
MSDS |