ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85099-21-4 חומצה מטאקרילית, תרכובת עם 2-(dimethylamino)אתנול (1: 1) |
|
שם המוצר | חומצה מטאקרילית, תרכובת עם 2-(dimethylamino)אתנול (1: 1) |
נרדפות | חומצה מתקרילית, תרכובת עם 2-(dimethylamino)אתנול (1: 1); 2-methylprop-2-חומצה enoic - 2-(dimethylamino)אתנול (1: 1); |
שם אנגלי | methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);Methacrylic acid, compound with 2-(dimethylamino)ethanol (1:1);2-methylprop-2-enoic acid - 2-(dimethylamino)ethanol (1:1) |
מולקולרית פורמולה | C8H17NO3 |
משקל מולקולרי | 175.2255 |
InChl | InChI=1/C4H11NO.C4H6O2/c1-5(2)3-4-6;1-3(2)4(5)6/h6H,3-4H2,1-2H3;1H2,2H3,(H,5,6) |
מספר CAS | 85099-21-4 |
EINECS | 285-475-4 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 312.8°C at 760 mmHg |
נקודת הבזק | 143°C |
לחץ אדים | 4.53E-05mmHg at 25°C |
MSDS |