ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90721-27-0 1-benzofuran-5-carboxylic acid |
|
Produkt-Name | 1-benzofuran-5-carboxylic acid |
Englischer Name | 1-benzofuran-5-carboxylic acid; |
Molekulare Formel | C9H6O3 |
Molecular Weight | 162.1421 |
InChl | InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
CAS Registry Number | 90721-27-0 |
Molecular Structure | ![]() |
Dichte | 1.363g/cm3 |
Schmelzpunkt | 188℃ |
Siedepunkt | 325.6°C at 760 mmHg |
Brechungsindex | 1.649 |
Flammpunkt | 150.7°C |
Dampfdruck | 9.31E-05mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |