ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90721-27-0 1-benzofuran-5-carboxylic acid |
|
produktnavn | 1-benzofuran-5-carboxylic acid |
Engelsk navn | 1-benzofuran-5-carboxylic acid; |
Molekylær Formel | C9H6O3 |
Molekylvekt | 162.1421 |
InChI | InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
CAS-nummer | 90721-27-0 |
Molecular Structure | ![]() |
Tetthet | 1.363g/cm3 |
Smeltepunkt | 188℃ |
Kokepunkt | 325.6°C at 760 mmHg |
Brytningsindeks | 1.649 |
Flammepunktet | 150.7°C |
Damptrykk | 9.31E-05mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |