Chemindex > 90721-27-0
KR ▼
90721-27-0 1-benzofuran-5-carboxylic acid |
|
| 상품명칭 | 1-benzofuran-5-carboxylic acid |
| 영문 이름 | 1-benzofuran-5-carboxylic acid; |
| 분자식 | C9H6O3 |
| 분자량 | 162.1421 |
| InChI | InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
| cas번호 | 90721-27-0 |
| 분자 구조 |  |
| 밀도 | 1.363g/cm3 |
| 녹는 점 | 188℃ |
| 비등점 | 325.6°C at 760 mmHg |
| 굴절 지수 | 1.649 |
| 인화점 | 150.7°C |
| 증기압 | 9.31E-05mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 