ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98800-10-3 Methylthieno[3,2-b]thiophen-2-carboxylat |
|
Produkt-Name | Methylthieno[3,2-b]thiophen-2-carboxylat |
Englischer Name | methyl thieno[3,2-b]thiophene-2-carboxylate; |
Molekulare Formel | C8H6O2S2 |
Molecular Weight | 198.262 |
InChl | InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
CAS Registry Number | 98800-10-3 |
Molecular Structure | ![]() |
Dichte | 1.412g/cm3 |
Schmelzpunkt | 94℃ |
Siedepunkt | 306.1°C at 760 mmHg |
Brechungsindex | 1.673 |
Flammpunkt | 138.9°C |
Dampfdruck | 0.000788mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |