ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98800-10-3 metil thieno[3,2-b]thiophene-2-carboxylate |
|
Nama produk | metil thieno[3,2-b]thiophene-2-carboxylate |
Nama Inggeris | methyl thieno[3,2-b]thiophene-2-carboxylate; |
MF | C8H6O2S2 |
Berat Molekul | 198.262 |
InChI | InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
CAS NO | 98800-10-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.412g/cm3 |
Titik lebur | 94℃ |
Titik didih | 306.1°C at 760 mmHg |
Indeks bias | 1.673 |
Titik nyala | 138.9°C |
Tekanan wap | 0.000788mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |