ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98800-10-3 메틸 티에노[3,2-b]티오펜-2-카르복실레이트 |
|
상품명칭 | 메틸 티에노[3,2-b]티오펜-2-카르복실레이트 |
영문 이름 | methyl thieno[3,2-b]thiophene-2-carboxylate; |
분자식 | C8H6O2S2 |
분자량 | 198.262 |
InChI | InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
cas번호 | 98800-10-3 |
분자 구조 | ![]() |
밀도 | 1.412g/cm3 |
녹는 점 | 94℃ |
비등점 | 306.1°C at 760 mmHg |
굴절 지수 | 1.673 |
인화점 | 138.9°C |
증기압 | 0.000788mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |