ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52709-87-2 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
|
| Nom | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
| Nom anglais | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile;[1,1'-biphenyl]-4-carbonitrile, 4'-butoxy-;258-123-2;4'-butoxybiphenyl-4-carbonitrile;4-Butoxyl-[1,1'-biphenyl]-4'-carbonitrile |
| Formule moléculaire | C17H17NO |
| Poids Moléculaire | 251.323 |
| InChl | InChI=1/C17H17NO/c1-2-3-12-19-17-10-8-16(9-11-17)15-6-4-14(13-18)5-7-15/h4-11H,2-3,12H2,1H3 |
| Numéro de registre CAS | 52709-87-2 |
| EINECS | 258-123-2 |
| Structure moléculaire | ![]() |
| Densité | 1.08g/cm3 |
| Point d'ébullition | 405.5°C at 760 mmHg |
| Indice de réfraction | 1.573 |
| Point d'éclair | 170.3°C |
| Pression de vapeur | 8.72E-07mmHg at 25°C |
| MSDS | |