ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52709-87-2 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
|
| 상품명칭 | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
| 영문 이름 | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile;[1,1'-biphenyl]-4-carbonitrile, 4'-butoxy-;258-123-2;4'-butoxybiphenyl-4-carbonitrile;4-Butoxyl-[1,1'-biphenyl]-4'-carbonitrile |
| 분자식 | C17H17NO |
| 분자량 | 251.323 |
| InChI | InChI=1/C17H17NO/c1-2-3-12-19-17-10-8-16(9-11-17)15-6-4-14(13-18)5-7-15/h4-11H,2-3,12H2,1H3 |
| cas번호 | 52709-87-2 |
| EC번호 | 258-123-2 |
| 분자 구조 | ![]() |
| 밀도 | 1.08g/cm3 |
| 비등점 | 405.5°C at 760 mmHg |
| 굴절 지수 | 1.573 |
| 인화점 | 170.3°C |
| 증기압 | 8.72E-07mmHg at 25°C |
| MSDS | |