ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52709-87-2 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
|
| Ürün Adı | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile |
| ingilizce adı | 4'-butoxy[1,1'-biphenyl]-4-carbonitrile;[1,1'-biphenyl]-4-carbonitrile, 4'-butoxy-;258-123-2;4'-butoxybiphenyl-4-carbonitrile;4-Butoxyl-[1,1'-biphenyl]-4'-carbonitrile |
| Moleküler Formülü | C17H17NO |
| Molekül Ağırlığı | 251.323 |
| InChI | InChI=1/C17H17NO/c1-2-3-12-19-17-10-8-16(9-11-17)15-6-4-14(13-18)5-7-15/h4-11H,2-3,12H2,1H3 |
| CAS kayıt numarası | 52709-87-2 |
| EINECS | 258-123-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.08g/cm3 |
| Kaynama noktası | 405.5°C at 760 mmHg |
| Kırılma indisi | 1.573 |
| Alevlenme noktası | 170.3°C |
| Buhar basıncı | 8.72E-07mmHg at 25°C |
| MSDS | |