ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-24-2 2,3,4-trifluorobenzyl alcohol |
|
Ονομασία του προϊόντος | 2,3,4-trifluorobenzyl alcohol |
Αγγλικό όνομα | 2,3,4-trifluorobenzyl alcohol;1,2,3-trifluoro-4-methoxybenzene;(2,3,4-trifluorophenyl)methanol |
MF | C7H5F3O |
Μοριακό βάρος | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
CAS ΟΧΙ | 144284-24-2 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.398g/cm3 |
Σημείο βρασμού | 195.5°C at 760 mmHg |
Δείκτης διάθλασης | 1.476 |
Σημείο ανάφλεξης | 84.5°C |
Πίεση ατμών | 0.261mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |