ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-24-2 2,3,4-trifluorobenzyl alcohol |
|
Ürün Adı | 2,3,4-trifluorobenzyl alcohol |
ingilizce adı | 2,3,4-trifluorobenzyl alcohol;1,2,3-trifluoro-4-methoxybenzene;(2,3,4-trifluorophenyl)methanol |
Moleküler Formülü | C7H5F3O |
Molekül Ağırlığı | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
CAS kayıt numarası | 144284-24-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.398g/cm3 |
Kaynama noktası | 195.5°C at 760 mmHg |
Kırılma indisi | 1.476 |
Alevlenme noktası | 84.5°C |
Buhar basıncı | 0.261mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |