ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-24-2 2,3,4-trifluorobenzyl alcohol |
|
उत्पाद का नाम | 2,3,4-trifluorobenzyl alcohol |
अंग्रेज | 2,3,4-trifluorobenzyl alcohol;1,2,3-trifluoro-4-methoxybenzene;(2,3,4-trifluorophenyl)methanol |
आणविक फार्मूला | C7H5F3O |
आण्विक वजन | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
कैस रजिस्टी संख्या | 144284-24-2 |
आणविक संरचना | ![]() |
घनत्व | 1.398g/cm3 |
उबलने का समय | 195.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.476 |
फ्लैश प्वाइंट | 84.5°C |
वाष्प का दबाव | 0.261mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |