ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile |
|
termék neve | 4-Amino-3-chloro-5-methylbenzonitrile |
Angol név | 4-Amino-3-chloro-5-methylbenzonitrile;2-Chloro-4-cyano-6-methylaniline |
MF | C8H7ClN2 |
Molekulatömeg | 166.6076 |
InChI | InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
CAS-szám | 158296-69-6 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.27g/cm3 |
Forráspont | 302°C at 760 mmHg |
Törésmutató | 1.594 |
Gyulladáspont | 136.5°C |
Gőznyomás | 0.00102mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |