Chemindex > 158296-69-6
KR ▼
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile |
|
| 상품명칭 | 4-Amino-3-chloro-5-methylbenzonitrile |
| 영문 이름 | 4-Amino-3-chloro-5-methylbenzonitrile;2-Chloro-4-cyano-6-methylaniline |
| 분자식 | C8H7ClN2 |
| 분자량 | 166.6076 |
| InChI | InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| cas번호 | 158296-69-6 |
| 분자 구조 |  |
| 밀도 | 1.27g/cm3 |
| 비등점 | 302°C at 760 mmHg |
| 굴절 지수 | 1.594 |
| 인화점 | 136.5°C |
| 증기압 | 0.00102mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 