ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile |
|
उत्पाद का नाम | 4-Amino-3-chloro-5-methylbenzonitrile |
अंग्रेज | 4-Amino-3-chloro-5-methylbenzonitrile;2-Chloro-4-cyano-6-methylaniline |
आणविक फार्मूला | C8H7ClN2 |
आण्विक वजन | 166.6076 |
InChI | InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
कैस रजिस्टी संख्या | 158296-69-6 |
आणविक संरचना | ![]() |
घनत्व | 1.27g/cm3 |
उबलने का समय | 302°C at 760 mmHg |
अपवर्तक सूचकांक | 1.594 |
फ्लैश प्वाइंट | 136.5°C |
वाष्प का दबाव | 0.00102mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |