ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
19056-40-7 4-Bromo-3-methoxyaniline |
|
termék neve | 4-Bromo-3-methoxyaniline |
Angol név | 4-Bromo-3-methoxyaniline;4-Bromo-m-anisidine;4-nitrophenyl 2-aminobenzoate;4-Bromo-3-Methoxy-Phenylamine;5-Amino-2-bromoanisole |
MF | C13H10N2O4 |
Molekulatömeg | 258.2295 |
InChI | InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
CAS-szám | 19056-40-7 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.381g/cm3 |
Forráspont | 467°C at 760 mmHg |
Törésmutató | 1.655 |
Gyulladáspont | 236.2°C |
Gőznyomás | 6.74E-09mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |